C13H16N3O4S- — CID 9071429
2-[2-methoxy-4-[(Z)-C-methyl-N-(methylcarbamothioylamino)carbonimidoyl]phenoxy]acetate (PubChem CID 9071429) has the molecular formula C13H16N3O4S- and a molecular weight of 310.36 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(Z)-C-methyl-N-(methylcarbamothioylamino)carbonimidoyl]phenoxy]acetate.
| Compound Name | 2-[2-methoxy-4-[(Z)-C-methyl-N-(methylcarbamothioylamino)carbonimidoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 9071429 |
| Molecular Formula | C13H16N3O4S- |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2-[2-methoxy-4-[(Z)-C-methyl-N-(methylcarbamothioylamino)carbonimidoyl]phenoxy]acetate |
| SMILES | CNC(=S)N/N=C(/C)c1ccc(OCC(=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C13H17N3O4S/c1-8(15-16-13(21)14-2)9-4-5-10(11(6-9)19-3)20-7-12(17)18/h4-6H,7H2,1-3H3,(H,17,18)(H2,14,16,21)/p-1/b15-8- |
| InChIKey | HXXVAMOJANWRIC-NVNXTCNLSA-M |
| XLogP | -0.36 |
| TPSA | 95.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|