C20H22N2O7 — CID 9460657
2-[4-[(Z)-N-[(3,5-dimethoxybenzoyl)amino]-C-methylcarbonimidoyl]-2-methoxyphenoxy]acetic acid (PubChem CID 9460657) has the molecular formula C20H22N2O7 and a molecular weight of 402.40 g/mol. Its IUPAC name is 2-[4-[(Z)-N-[(3,5-dimethoxybenzoyl)amino]-C-methylcarbonimidoyl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-N-[(3,5-dimethoxybenzoyl)amino]-C-methylcarbonimidoyl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 9460657 |
| Molecular Formula | C20H22N2O7 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2-[4-[(Z)-N-[(3,5-dimethoxybenzoyl)amino]-C-methylcarbonimidoyl]-2-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(OC)cc(C(=O)N/N=C(/C)c2ccc(OCC(=O)O)c(OC)c2)c1 |
| InChI | InChI=1S/C20H22N2O7/c1-12(13-5-6-17(18(9-13)28-4)29-11-19(23)24)21-22-20(25)14-7-15(26-2)10-16(8-14)27-3/h5-10H,11H2,1-4H3,(H,22,25)(H,23,24)/b21-12- |
| InChIKey | GDMYFJOPAVEPEP-MTJSOVHGSA-N |
| XLogP | 2.33 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|