C19H22N2O4 — CID 9461201
N-[(Z)-1-(4-ethoxyphenyl)ethylideneamino]-3,5-dimethoxybenzamide (PubChem CID 9461201) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[(Z)-1-(4-ethoxyphenyl)ethylideneamino]-3,5-dimethoxybenzamide.
| Compound Name | N-[(Z)-1-(4-ethoxyphenyl)ethylideneamino]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 9461201 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-[(Z)-1-(4-ethoxyphenyl)ethylideneamino]-3,5-dimethoxybenzamide |
| SMILES | CCOc1ccc(/C(C)=N\NC(=O)c2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C19H22N2O4/c1-5-25-16-8-6-14(7-9-16)13(2)20-21-19(22)15-10-17(23-3)12-18(11-15)24-4/h6-12H,5H2,1-4H3,(H,21,22)/b20-13- |
| InChIKey | QNFSOUKDNDCOKC-MOSHPQCFSA-N |
| XLogP | 3.26 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|