C20H23N3O4 — CID 1018787
3,5-dimethoxy-N-[1-[4-(propanoylamino)phenyl]ethylideneamino]benzamide (PubChem CID 1018787) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[1-[4-(propanoylamino)phenyl]ethylideneamino]benzamide.
| Compound Name | 3,5-dimethoxy-N-[1-[4-(propanoylamino)phenyl]ethylideneamino]benzamide |
|---|---|
| PubChem CID | 1018787 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 3,5-dimethoxy-N-[1-[4-(propanoylamino)phenyl]ethylideneamino]benzamide |
| SMILES | CCC(=O)Nc1ccc(C(C)=NNC(=O)c2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C20H23N3O4/c1-5-19(24)21-16-8-6-14(7-9-16)13(2)22-23-20(25)15-10-17(26-3)12-18(11-15)27-4/h6-12H,5H2,1-4H3,(H,21,24)(H,23,25) |
| InChIKey | GLJFXDWMKMRIHU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|