C20H21ClN2O6 — CID 9316726
2-[4-[(Z)-N-[[2-(4-chloro-3-methylphenoxy)acetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenoxy]acetic acid (PubChem CID 9316726) has the molecular formula C20H21ClN2O6 and a molecular weight of 420.85 g/mol. Its IUPAC name is 2-[4-[(Z)-N-[[2-(4-chloro-3-methylphenoxy)acetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-N-[[2-(4-chloro-3-methylphenoxy)acetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 9316726 |
| Molecular Formula | C20H21ClN2O6 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 2-[4-[(Z)-N-[[2-(4-chloro-3-methylphenoxy)acetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(/C(C)=N\NC(=O)COc2ccc(Cl)c(C)c2)ccc1OCC(=O)O |
| InChI | InChI=1S/C20H21ClN2O6/c1-12-8-15(5-6-16(12)21)28-10-19(24)23-22-13(2)14-4-7-17(18(9-14)27-3)29-11-20(25)26/h4-9H,10-11H2,1-3H3,(H,23,24)(H,25,26)/b22-13- |
| InChIKey | HLHLNEIQIGQXCP-XKZIYDEJSA-N |
| XLogP | 3.04 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|