C19H19ClN2O5 — CID 9317091
2-[4-[(Z)-N-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]-C-methylcarbonimidoyl]phenoxy]acetic acid (PubChem CID 9317091) has the molecular formula C19H19ClN2O5 and a molecular weight of 390.82 g/mol. Its IUPAC name is 2-[4-[(Z)-N-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]-C-methylcarbonimidoyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-N-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]-C-methylcarbonimidoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 9317091 |
| Molecular Formula | C19H19ClN2O5 |
| Molecular Weight | 390.82 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 2-[4-[(Z)-N-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]-C-methylcarbonimidoyl]phenoxy]acetic acid |
| SMILES | C/C(=N/NC(=O)COc1ccc(Cl)cc1C)c1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C19H19ClN2O5/c1-12-9-15(20)5-8-17(12)27-10-18(23)22-21-13(2)14-3-6-16(7-4-14)26-11-19(24)25/h3-9H,10-11H2,1-2H3,(H,22,23)(H,24,25)/b21-13- |
| InChIKey | JYRJEHMFPONBSQ-BKUYFWCQSA-N |
| XLogP | 3.03 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.82 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|