C16H15Cl2N3O2 — CID 7957341
N-[(E)-1-(4-aminophenyl)ethylideneamino]-2-(2,4-dichlorophenoxy)acetamide (PubChem CID 7957341) has the molecular formula C16H15Cl2N3O2 and a molecular weight of 352.22 g/mol. Its IUPAC name is N-[(E)-1-(4-aminophenyl)ethylideneamino]-2-(2,4-dichlorophenoxy)acetamide.
| Compound Name | N-[(E)-1-(4-aminophenyl)ethylideneamino]-2-(2,4-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 7957341 |
| Molecular Formula | C16H15Cl2N3O2 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | N-[(E)-1-(4-aminophenyl)ethylideneamino]-2-(2,4-dichlorophenoxy)acetamide |
| SMILES | C/C(=N\NC(=O)COc1ccc(Cl)cc1Cl)c1ccc(N)cc1 |
| InChI | InChI=1S/C16H15Cl2N3O2/c1-10(11-2-5-13(19)6-3-11)20-21-16(22)9-23-15-7-4-12(17)8-14(15)18/h2-8H,9,19H2,1H3,(H,21,22)/b20-10+ |
| InChIKey | RYKUSRNYQYLKPA-KEBDBYFISA-N |
| XLogP | 3.49 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_anil(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|