C17H18N3O5S- — CID 9463684
2-[2-methoxy-4-[(Z)-C-methyl-N-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]carbonimidoyl]phenoxy]acetate (PubChem CID 9463684) has the molecular formula C17H18N3O5S- and a molecular weight of 376.41 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(Z)-C-methyl-N-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]carbonimidoyl]phenoxy]acetate.
| Compound Name | 2-[2-methoxy-4-[(Z)-C-methyl-N-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]carbonimidoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 9463684 |
| Molecular Formula | C17H18N3O5S- |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 2-[2-methoxy-4-[(Z)-C-methyl-N-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]carbonimidoyl]phenoxy]acetate |
| SMILES | COc1cc(/C(C)=N\NC(=O)Cc2csc(C)n2)ccc1OCC(=O)[O-] |
| InChI | InChI=1S/C17H19N3O5S/c1-10(19-20-16(21)7-13-9-26-11(2)18-13)12-4-5-14(15(6-12)24-3)25-8-17(22)23/h4-6,9H,7-8H2,1-3H3,(H,20,21)(H,22,23)/p-1/b19-10- |
| InChIKey | ALACLZUXZMQDCL-GRSHGNNSSA-M |
| XLogP | 0.67 |
| TPSA | 112.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|