C17H18Cl2N6O3 — CID 3609681
8-[2-[1-(2,4-dichlorophenoxy)propan-2-ylidene]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione (PubChem CID 3609681) has the molecular formula C17H18Cl2N6O3 and a molecular weight of 425.28 g/mol. Its IUPAC name is 8-[2-[1-(2,4-dichlorophenoxy)propan-2-ylidene]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-[2-[1-(2,4-dichlorophenoxy)propan-2-ylidene]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 3609681 |
| Molecular Formula | C17H18Cl2N6O3 |
| Molecular Weight | 425.28 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 8-[2-[1-(2,4-dichlorophenoxy)propan-2-ylidene]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione |
| SMILES | CC(COc1ccc(Cl)cc1Cl)=NNc1nc2c(c(=O)n(C)c(=O)n2C)n1C |
| InChI | InChI=1S/C17H18Cl2N6O3/c1-9(8-28-12-6-5-10(18)7-11(12)19)21-22-16-20-14-13(23(16)2)15(26)25(4)17(27)24(14)3/h5-7H,8H2,1-4H3,(H,20,22) |
| InChIKey | XSIIZWDYNWXDEO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|