C18H21ClN6O3 — CID 7005654
8-[2-[3-(4-chloro-3-methylphenoxy)prop-1-en-2-yl]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione (PubChem CID 7005654) has the molecular formula C18H21ClN6O3 and a molecular weight of 404.86 g/mol. Its IUPAC name is 8-[2-[3-(4-chloro-3-methylphenoxy)prop-1-en-2-yl]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-[2-[3-(4-chloro-3-methylphenoxy)prop-1-en-2-yl]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 7005654 |
| Molecular Formula | C18H21ClN6O3 |
| Molecular Weight | 404.86 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 8-[2-[3-(4-chloro-3-methylphenoxy)prop-1-en-2-yl]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione |
| SMILES | C=C(COc1ccc(Cl)c(C)c1)NNc1nc2c(c(=O)n(C)c(=O)n2C)n1C |
| InChI | InChI=1S/C18H21ClN6O3/c1-10-8-12(6-7-13(10)19)28-9-11(2)21-22-17-20-15-14(23(17)3)16(26)25(5)18(27)24(15)4/h6-8,21H,2,9H2,1,3-5H3,(H,20,22) |
| InChIKey | VXIDRYYNNQVCAZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 95.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.86 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|