C13H13BrN4O3 — CID 43935375
3-bromo-N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)benzohydrazide (PubChem CID 43935375) has the molecular formula C13H13BrN4O3 and a molecular weight of 353.18 g/mol. Its IUPAC name is 3-bromo-N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)benzohydrazide.
| Compound Name | 3-bromo-N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)benzohydrazide |
|---|---|
| PubChem CID | 43935375 |
| Molecular Formula | C13H13BrN4O3 |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 3-bromo-N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)benzohydrazide |
| SMILES | Cn1c(NNC(=O)c2cccc(Br)c2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C13H13BrN4O3/c1-17-10(7-11(19)18(2)13(17)21)15-16-12(20)8-4-3-5-9(14)6-8/h3-7,15H,1-2H3,(H,16,20) |
| InChIKey | ZHKLBVAAOSROEC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|