C19H14N4O5 — CID 16841429
N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-5-yl)-2-oxochromene-3-carboxamide (PubChem CID 16841429) has the molecular formula C19H14N4O5 and a molecular weight of 378.34 g/mol. Its IUPAC name is N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-5-yl)-2-oxochromene-3-carboxamide.
| Compound Name | N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-5-yl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 16841429 |
| Molecular Formula | C19H14N4O5 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-5-yl)-2-oxochromene-3-carboxamide |
| SMILES | Cn1c(=O)c2c(NC(=O)c3cc4ccccc4oc3=O)ccnc2n(C)c1=O |
| InChI | InChI=1S/C19H14N4O5/c1-22-15-14(17(25)23(2)19(22)27)12(7-8-20-15)21-16(24)11-9-10-5-3-4-6-13(10)28-18(11)26/h3-9H,1-2H3,(H,20,21,24) |
| InChIKey | CCPXQVHNTZDBHE-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|