C14H11N5O6 — CID 16841424
N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-5-yl)-5-nitrofuran-2-carboxamide (PubChem CID 16841424) has the molecular formula C14H11N5O6 and a molecular weight of 345.27 g/mol. Its IUPAC name is N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-5-yl)-5-nitrofuran-2-carboxamide.
| Compound Name | N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-5-yl)-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 16841424 |
| Molecular Formula | C14H11N5O6 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-5-yl)-5-nitrofuran-2-carboxamide |
| SMILES | Cn1c(=O)c2c(NC(=O)c3ccc([N+](=O)[O-])o3)ccnc2n(C)c1=O |
| InChI | InChI=1S/C14H11N5O6/c1-17-11-10(13(21)18(2)14(17)22)7(5-6-15-11)16-12(20)8-3-4-9(25-8)19(23)24/h3-6H,1-2H3,(H,15,16,20) |
| InChIKey | VLYFIXNAFUGKOX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 142.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|