C15H17NO3 — CID 110473782
N-(2,2-dimethylpropyl)-2-oxochromene-3-carboxamide (PubChem CID 110473782) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-2-oxochromene-3-carboxamide.
| Compound Name | N-(2,2-dimethylpropyl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 110473782 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-(2,2-dimethylpropyl)-2-oxochromene-3-carboxamide |
| SMILES | CC(C)(C)CNC(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C15H17NO3/c1-15(2,3)9-16-13(17)11-8-10-6-4-5-7-12(10)19-14(11)18/h4-8H,9H2,1-3H3,(H,16,17) |
| InChIKey | LPJYNCLWGFYHHB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|