C21H21NO4 — CID 90498518
N-(2-hydroxy-2-methyl-4-phenylbutyl)-2-oxochromene-3-carboxamide (PubChem CID 90498518) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is N-(2-hydroxy-2-methyl-4-phenylbutyl)-2-oxochromene-3-carboxamide.
| Compound Name | N-(2-hydroxy-2-methyl-4-phenylbutyl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 90498518 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | N-(2-hydroxy-2-methyl-4-phenylbutyl)-2-oxochromene-3-carboxamide |
| SMILES | CC(O)(CCc1ccccc1)CNC(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C21H21NO4/c1-21(25,12-11-15-7-3-2-4-8-15)14-22-19(23)17-13-16-9-5-6-10-18(16)26-20(17)24/h2-10,13,25H,11-12,14H2,1H3,(H,22,23) |
| InChIKey | YKOSSOOYGXGOHR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|