C18H19Cl2NO2 — CID 90498520
2,5-dichloro-N-(2-hydroxy-2-methyl-4-phenylbutyl)benzamide (PubChem CID 90498520) has the molecular formula C18H19Cl2NO2 and a molecular weight of 352.26 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-hydroxy-2-methyl-4-phenylbutyl)benzamide.
| Compound Name | 2,5-dichloro-N-(2-hydroxy-2-methyl-4-phenylbutyl)benzamide |
|---|---|
| PubChem CID | 90498520 |
| Molecular Formula | C18H19Cl2NO2 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 2,5-dichloro-N-(2-hydroxy-2-methyl-4-phenylbutyl)benzamide |
| SMILES | CC(O)(CCc1ccccc1)CNC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H19Cl2NO2/c1-18(23,10-9-13-5-3-2-4-6-13)12-21-17(22)15-11-14(19)7-8-16(15)20/h2-8,11,23H,9-10,12H2,1H3,(H,21,22) |
| InChIKey | OSPDDDPYQQUAOS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |