C19H22ClNO2 — CID 52906943
2-(4-chlorophenyl)-N-[(2S)-2-hydroxy-2-methyl-4-phenylbutyl]acetamide (PubChem CID 52906943) has the molecular formula C19H22ClNO2 and a molecular weight of 331.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(2S)-2-hydroxy-2-methyl-4-phenylbutyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(2S)-2-hydroxy-2-methyl-4-phenylbutyl]acetamide |
|---|---|
| PubChem CID | 52906943 |
| Molecular Formula | C19H22ClNO2 |
| Molecular Weight | 331.84 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(2S)-2-hydroxy-2-methyl-4-phenylbutyl]acetamide |
| SMILES | C[C@](O)(CCc1ccccc1)CNC(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22ClNO2/c1-19(23,12-11-15-5-3-2-4-6-15)14-21-18(22)13-16-7-9-17(20)10-8-16/h2-10,23H,11-14H2,1H3,(H,21,22)/t19-/m0/s1 |
| InChIKey | OKWJGOWZDUGBEJ-IBGZPJMESA-N |
| XLogP | 3.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.84 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |