C24H20N2O3 — CID 9293863
N',N'-dibenzyl-2-oxochromene-3-carbohydrazide (PubChem CID 9293863) has the molecular formula C24H20N2O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is N',N'-dibenzyl-2-oxochromene-3-carbohydrazide.
| Compound Name | N',N'-dibenzyl-2-oxochromene-3-carbohydrazide |
|---|---|
| PubChem CID | 9293863 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N',N'-dibenzyl-2-oxochromene-3-carbohydrazide |
| SMILES | O=C(NN(Cc1ccccc1)Cc1ccccc1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C24H20N2O3/c27-23(21-15-20-13-7-8-14-22(20)29-24(21)28)25-26(16-18-9-3-1-4-10-18)17-19-11-5-2-6-12-19/h1-15H,16-17H2,(H,25,27) |
| InChIKey | IXXMNSZTCIVYSX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|