2-oxochromene-3-carboxylic acid

C20H12O8 — CID 161011590

IUPAC2-oxochromene-3-carboxylic acid
SMILESO=C(O)c1cc2ccccc2oc1=O.O=C(O)c1cc2ccccc2oc1=O
InChIInChI=1S/2C10H6O4/c2*11-9(12)7-5-6-3-1-2-4-8(6)14-10(7)13/h2*1-5H,(H,11,12)
InChIKeyTXEPLPATLCFFAN-UHFFFAOYSA-N
MW380.31 g/mol
LogP2.98
Rot. Bonds2

About 2-oxochromene-3-carboxylic acid

2-oxochromene-3-carboxylic acid (PubChem CID 161011590) has the molecular formula C20H12O8 and a molecular weight of 380.31 g/mol. Its IUPAC name is 2-oxochromene-3-carboxylic acid.

Molecular Properties

Compound Name2-oxochromene-3-carboxylic acid
PubChem CID161011590
Molecular FormulaC20H12O8
Molecular Weight380.31 g/mol
Exact Mass380.05
IUPAC Name2-oxochromene-3-carboxylic acid
SMILESO=C(O)c1cc2ccccc2oc1=O.O=C(O)c1cc2ccccc2oc1=O
InChIInChI=1S/2C10H6O4/c2*11-9(12)7-5-6-3-1-2-4-8(6)14-10(7)13/h2*1-5H,(H,11,12)
InChIKeyTXEPLPATLCFFAN-UHFFFAOYSA-N
XLogP2.98
TPSA135.02 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms28
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500380.31
LogP ≤ 52.98
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'cumarine', 'substructure': 'N/A'}

Analyze 2-oxochromene-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-oxochromene-3-carboxylic acid?
The IUPAC name of 2-oxochromene-3-carboxylic acid (CID 161011590) is 2-oxochromene-3-carboxylic acid.
What is the SMILES notation for 2-oxochromene-3-carboxylic acid?
The canonical SMILES for 2-oxochromene-3-carboxylic acid is O=C(O)c1cc2ccccc2oc1=O.O=C(O)c1cc2ccccc2oc1=O.
What is the InChIKey of 2-oxochromene-3-carboxylic acid?
The InChIKey is TXEPLPATLCFFAN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H6O4/c2*11-9(12)7-5-6-3-1-2-4-8(6)14-10(7)13/h2*1-5H,(H,11,12).
What are the key properties of 2-oxochromene-3-carboxylic acid?
2-oxochromene-3-carboxylic acid has a molecular weight of 380.31 g/mol, XLogP of 2.98, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxochromene-3-carboxylic acid is sourced from PubChem (CID 161011590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).