C18H12O4 — CID 11231641
3-[(2S,3R)-3-phenyloxirane-2-carbonyl]chromen-2-one (PubChem CID 11231641) has the molecular formula C18H12O4 and a molecular weight of 292.29 g/mol. Its IUPAC name is 3-[(2S,3R)-3-phenyloxirane-2-carbonyl]chromen-2-one.
| Compound Name | 3-[(2S,3R)-3-phenyloxirane-2-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 11231641 |
| Molecular Formula | C18H12O4 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 3-[(2S,3R)-3-phenyloxirane-2-carbonyl]chromen-2-one |
| SMILES | O=C(c1cc2ccccc2oc1=O)[C@H]1O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H12O4/c19-15(17-16(22-17)11-6-2-1-3-7-11)13-10-12-8-4-5-9-14(12)21-18(13)20/h1-10,16-17H/t16-,17-/m1/s1 |
| InChIKey | TXRWEKMDGMCQMO-IAGOWNOFSA-N |
| XLogP | 3.12 |
| TPSA | 59.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|