C15H13NO2 — CID 11139205
(2-aminophenyl)-[(2R,3S)-3-phenyloxiran-2-yl]methanone (PubChem CID 11139205) has the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. Its IUPAC name is (2-aminophenyl)-[(2R,3S)-3-phenyloxiran-2-yl]methanone.
| Compound Name | (2-aminophenyl)-[(2R,3S)-3-phenyloxiran-2-yl]methanone |
|---|---|
| PubChem CID | 11139205 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | (2-aminophenyl)-[(2R,3S)-3-phenyloxiran-2-yl]methanone |
| SMILES | Nc1ccccc1C(=O)[C@@H]1O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H13NO2/c16-12-9-5-4-8-11(12)13(17)15-14(18-15)10-6-2-1-3-7-10/h1-9,14-15H,16H2/t14-,15-/m0/s1 |
| InChIKey | XZOFYBSUOARQRH-GJZGRUSLSA-N |
| XLogP | 2.59 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|