C18H11ClO4 — CID 11198188
3-[(2S,3R)-3-(4-chlorophenyl)oxirane-2-carbonyl]chromen-2-one (PubChem CID 11198188) has the molecular formula C18H11ClO4 and a molecular weight of 326.74 g/mol. Its IUPAC name is 3-[(2S,3R)-3-(4-chlorophenyl)oxirane-2-carbonyl]chromen-2-one.
| Compound Name | 3-[(2S,3R)-3-(4-chlorophenyl)oxirane-2-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 11198188 |
| Molecular Formula | C18H11ClO4 |
| Molecular Weight | 326.74 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 3-[(2S,3R)-3-(4-chlorophenyl)oxirane-2-carbonyl]chromen-2-one |
| SMILES | O=C(c1cc2ccccc2oc1=O)[C@H]1O[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H11ClO4/c19-12-7-5-10(6-8-12)16-17(23-16)15(20)13-9-11-3-1-2-4-14(11)22-18(13)21/h1-9,16-17H/t16-,17-/m1/s1 |
| InChIKey | NCTBAHUMYYLRCH-IAGOWNOFSA-N |
| XLogP | 3.77 |
| TPSA | 59.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.74 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|