C26H18ClNO5 — CID 1289138
(3S)-1-[(4-chlorophenyl)methyl]-3-hydroxy-3-[2-oxo-2-(2-oxochromen-3-yl)ethyl]indol-2-one (PubChem CID 1289138) has the molecular formula C26H18ClNO5 and a molecular weight of 459.89 g/mol. Its IUPAC name is (3S)-1-[(4-chlorophenyl)methyl]-3-hydroxy-3-[2-oxo-2-(2-oxochromen-3-yl)ethyl]indol-2-one.
| Compound Name | (3S)-1-[(4-chlorophenyl)methyl]-3-hydroxy-3-[2-oxo-2-(2-oxochromen-3-yl)ethyl]indol-2-one |
|---|---|
| PubChem CID | 1289138 |
| Molecular Formula | C26H18ClNO5 |
| Molecular Weight | 459.89 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | (3S)-1-[(4-chlorophenyl)methyl]-3-hydroxy-3-[2-oxo-2-(2-oxochromen-3-yl)ethyl]indol-2-one |
| SMILES | O=C(C[C@@]1(O)C(=O)N(Cc2ccc(Cl)cc2)c2ccccc21)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C26H18ClNO5/c27-18-11-9-16(10-12-18)15-28-21-7-3-2-6-20(21)26(32,25(28)31)14-22(29)19-13-17-5-1-4-8-23(17)33-24(19)30/h1-13,32H,14-15H2/t26-/m0/s1 |
| InChIKey | LFVUFCCIHWDHOZ-SANMLTNESA-N |
| XLogP | 4.45 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.89 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|