C23H21NO5 — CID 172646021
3-hydroxy-1-(2-methylpropyl)-3-[2-oxo-2-(2-oxochromen-3-yl)ethyl]indol-2-one (PubChem CID 172646021) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is 3-hydroxy-1-(2-methylpropyl)-3-[2-oxo-2-(2-oxochromen-3-yl)ethyl]indol-2-one.
| Compound Name | 3-hydroxy-1-(2-methylpropyl)-3-[2-oxo-2-(2-oxochromen-3-yl)ethyl]indol-2-one |
|---|---|
| PubChem CID | 172646021 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 3-hydroxy-1-(2-methylpropyl)-3-[2-oxo-2-(2-oxochromen-3-yl)ethyl]indol-2-one |
| SMILES | CC(C)CN1C(=O)C(O)(CC(=O)c2cc3ccccc3oc2=O)c2ccccc21 |
| InChI | InChI=1S/C23H21NO5/c1-14(2)13-24-18-9-5-4-8-17(18)23(28,22(24)27)12-19(25)16-11-15-7-3-6-10-20(15)29-21(16)26/h3-11,14,28H,12-13H2,1-2H3 |
| InChIKey | ZQWZDQUQRNSVGD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|