C28H23NO6 — CID 1308105
(3R)-3-hydroxy-3-[2-(8-methoxy-2-oxochromen-3-yl)-2-oxoethyl]-1-(2-phenylethyl)indol-2-one (PubChem CID 1308105) has the molecular formula C28H23NO6 and a molecular weight of 469.49 g/mol. Its IUPAC name is (3R)-3-hydroxy-3-[2-(8-methoxy-2-oxochromen-3-yl)-2-oxoethyl]-1-(2-phenylethyl)indol-2-one.
| Compound Name | (3R)-3-hydroxy-3-[2-(8-methoxy-2-oxochromen-3-yl)-2-oxoethyl]-1-(2-phenylethyl)indol-2-one |
|---|---|
| PubChem CID | 1308105 |
| Molecular Formula | C28H23NO6 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | (3R)-3-hydroxy-3-[2-(8-methoxy-2-oxochromen-3-yl)-2-oxoethyl]-1-(2-phenylethyl)indol-2-one |
| SMILES | COc1cccc2cc(C(=O)C[C@]3(O)C(=O)N(CCc4ccccc4)c4ccccc43)c(=O)oc12 |
| InChI | InChI=1S/C28H23NO6/c1-34-24-13-7-10-19-16-20(26(31)35-25(19)24)23(30)17-28(33)21-11-5-6-12-22(21)29(27(28)32)15-14-18-8-3-2-4-9-18/h2-13,16,33H,14-15,17H2,1H3/t28-/m1/s1 |
| InChIKey | QFLBTVVHOHGXNK-MUUNZHRXSA-N |
| XLogP | 3.85 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|