C23H21NO4 — CID 3486846
3-hydroxy-3-[2-(5-methylfuran-2-yl)-2-oxoethyl]-1-(2-phenylethyl)indol-2-one (PubChem CID 3486846) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is 3-hydroxy-3-[2-(5-methylfuran-2-yl)-2-oxoethyl]-1-(2-phenylethyl)indol-2-one.
| Compound Name | 3-hydroxy-3-[2-(5-methylfuran-2-yl)-2-oxoethyl]-1-(2-phenylethyl)indol-2-one |
|---|---|
| PubChem CID | 3486846 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 3-hydroxy-3-[2-(5-methylfuran-2-yl)-2-oxoethyl]-1-(2-phenylethyl)indol-2-one |
| SMILES | Cc1ccc(C(=O)CC2(O)C(=O)N(CCc3ccccc3)c3ccccc32)o1 |
| InChI | InChI=1S/C23H21NO4/c1-16-11-12-21(28-16)20(25)15-23(27)18-9-5-6-10-19(18)24(22(23)26)14-13-17-7-3-2-4-8-17/h2-12,27H,13-15H2,1H3 |
| InChIKey | HMHUBWLCRHZGRG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |