C18H19NO4 — CID 95244730
(3R)-3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1-(2-methylpropyl)indol-2-one (PubChem CID 95244730) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is (3R)-3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1-(2-methylpropyl)indol-2-one.
| Compound Name | (3R)-3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1-(2-methylpropyl)indol-2-one |
|---|---|
| PubChem CID | 95244730 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (3R)-3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1-(2-methylpropyl)indol-2-one |
| SMILES | CC(C)CN1C(=O)[C@@](O)(CC(=O)c2ccco2)c2ccccc21 |
| InChI | InChI=1S/C18H19NO4/c1-12(2)11-19-14-7-4-3-6-13(14)18(22,17(19)21)10-15(20)16-8-5-9-23-16/h3-9,12,22H,10-11H2,1-2H3/t18-/m1/s1 |
| InChIKey | ZMTRDZFMUQUNJG-GOSISDBHSA-N |
| XLogP | 2.74 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |