C19H15NO4S — CID 17131251
3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1-(thiophen-2-ylmethyl)indol-2-one (PubChem CID 17131251) has the molecular formula C19H15NO4S and a molecular weight of 353.40 g/mol. Its IUPAC name is 3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1-(thiophen-2-ylmethyl)indol-2-one.
| Compound Name | 3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1-(thiophen-2-ylmethyl)indol-2-one |
|---|---|
| PubChem CID | 17131251 |
| Molecular Formula | C19H15NO4S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1-(thiophen-2-ylmethyl)indol-2-one |
| SMILES | O=C(CC1(O)C(=O)N(Cc2cccs2)c2ccccc21)c1ccco1 |
| InChI | InChI=1S/C19H15NO4S/c21-16(17-8-3-9-24-17)11-19(23)14-6-1-2-7-15(14)20(18(19)22)12-13-5-4-10-25-13/h1-10,23H,11-12H2 |
| InChIKey | HCUHNDGXDDOVNH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |