C19H14BrNO4S — CID 40918699
(3R)-5-bromo-3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1-(thiophen-2-ylmethyl)indol-2-one (PubChem CID 40918699) has the molecular formula C19H14BrNO4S and a molecular weight of 432.30 g/mol. Its IUPAC name is (3R)-5-bromo-3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1-(thiophen-2-ylmethyl)indol-2-one.
| Compound Name | (3R)-5-bromo-3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1-(thiophen-2-ylmethyl)indol-2-one |
|---|---|
| PubChem CID | 40918699 |
| Molecular Formula | C19H14BrNO4S |
| Molecular Weight | 432.30 g/mol |
| Exact Mass | 430.98 |
| IUPAC Name | (3R)-5-bromo-3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1-(thiophen-2-ylmethyl)indol-2-one |
| SMILES | O=C(C[C@]1(O)C(=O)N(Cc2cccs2)c2ccc(Br)cc21)c1ccco1 |
| InChI | InChI=1S/C19H14BrNO4S/c20-12-5-6-15-14(9-12)19(24,10-16(22)17-4-1-7-25-17)18(23)21(15)11-13-3-2-8-26-13/h1-9,24H,10-11H2/t19-/m1/s1 |
| InChIKey | PTPHKUKIVIJBOA-LJQANCHMSA-N |
| XLogP | 4.11 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.30 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |