C13H9NO5 — CID 102136563
3-(2-oxochromene-3-carbonyl)-1,3-oxazolidin-2-one (PubChem CID 102136563) has the molecular formula C13H9NO5 and a molecular weight of 259.22 g/mol. Its IUPAC name is 3-(2-oxochromene-3-carbonyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(2-oxochromene-3-carbonyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102136563 |
| Molecular Formula | C13H9NO5 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 3-(2-oxochromene-3-carbonyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1C(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C13H9NO5/c15-11(14-5-6-18-13(14)17)9-7-8-3-1-2-4-10(8)19-12(9)16/h1-4,7H,5-6H2 |
| InChIKey | FUCUENSSCXCPPF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|