C15H11NO5 — CID 95985334
(1R,4R)-5-(2-oxochromene-3-carbonyl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one (PubChem CID 95985334) has the molecular formula C15H11NO5 and a molecular weight of 285.25 g/mol. Its IUPAC name is (1R,4R)-5-(2-oxochromene-3-carbonyl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one.
| Compound Name | (1R,4R)-5-(2-oxochromene-3-carbonyl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one |
|---|---|
| PubChem CID | 95985334 |
| Molecular Formula | C15H11NO5 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | (1R,4R)-5-(2-oxochromene-3-carbonyl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one |
| SMILES | O=C1O[C@@H]2C[C@H]1N(C(=O)c1cc3ccccc3oc1=O)C2 |
| InChI | InChI=1S/C15H11NO5/c17-13(16-7-9-6-11(16)15(19)20-9)10-5-8-3-1-2-4-12(8)21-14(10)18/h1-5,9,11H,6-7H2/t9-,11-/m1/s1 |
| InChIKey | KBJUQXMJBJEHCZ-MWLCHTKSSA-N |
| XLogP | 0.93 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|