C14H11NO5S — CID 43097182
3-(2-oxochromene-3-carbonyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 43097182) has the molecular formula C14H11NO5S and a molecular weight of 305.31 g/mol. Its IUPAC name is 3-(2-oxochromene-3-carbonyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 3-(2-oxochromene-3-carbonyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 43097182 |
| Molecular Formula | C14H11NO5S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 3-(2-oxochromene-3-carbonyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)C1CSCN1C(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C14H11NO5S/c16-12(15-7-21-6-10(15)13(17)18)9-5-8-3-1-2-4-11(8)20-14(9)19/h1-5,10H,6-7H2,(H,17,18) |
| InChIKey | YOHCSZZYLFYLLC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|