C19H15N3O5S — CID 43953293
N'-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-2-oxochromene-3-carbohydrazide (PubChem CID 43953293) has the molecular formula C19H15N3O5S and a molecular weight of 397.41 g/mol. Its IUPAC name is N'-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-2-oxochromene-3-carbohydrazide.
| Compound Name | N'-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-2-oxochromene-3-carbohydrazide |
|---|---|
| PubChem CID | 43953293 |
| Molecular Formula | C19H15N3O5S |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | N'-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-2-oxochromene-3-carbohydrazide |
| SMILES | COc1ccc(OC)c2sc(NNC(=O)c3cc4ccccc4oc3=O)nc12 |
| InChI | InChI=1S/C19H15N3O5S/c1-25-13-7-8-14(26-2)16-15(13)20-19(28-16)22-21-17(23)11-9-10-5-3-4-6-12(10)27-18(11)24/h3-9H,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | RLKKANDXDIGUIP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|