C18H12ClN3O4S — CID 7590156
N'-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-2-oxochromene-3-carbohydrazide (PubChem CID 7590156) has the molecular formula C18H12ClN3O4S and a molecular weight of 401.83 g/mol. Its IUPAC name is N'-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-2-oxochromene-3-carbohydrazide.
| Compound Name | N'-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-2-oxochromene-3-carbohydrazide |
|---|---|
| PubChem CID | 7590156 |
| Molecular Formula | C18H12ClN3O4S |
| Molecular Weight | 401.83 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | N'-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-2-oxochromene-3-carbohydrazide |
| SMILES | COc1ccc(Cl)c2sc(NNC(=O)c3cc4ccccc4oc3=O)nc12 |
| InChI | InChI=1S/C18H12ClN3O4S/c1-25-13-7-6-11(19)15-14(13)20-18(27-15)22-21-16(23)10-8-9-4-2-3-5-12(9)26-17(10)24/h2-8H,1H3,(H,20,22)(H,21,23) |
| InChIKey | BDUDMWMQIOXKEV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.83 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|