C16H13Cl2N3O2S2 — CID 41074275
N'-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-2-(4-chlorophenyl)sulfanylacetohydrazide (PubChem CID 41074275) has the molecular formula C16H13Cl2N3O2S2 and a molecular weight of 414.34 g/mol. Its IUPAC name is N'-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-2-(4-chlorophenyl)sulfanylacetohydrazide.
| Compound Name | N'-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-2-(4-chlorophenyl)sulfanylacetohydrazide |
|---|---|
| PubChem CID | 41074275 |
| Molecular Formula | C16H13Cl2N3O2S2 |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 412.98 |
| IUPAC Name | N'-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-2-(4-chlorophenyl)sulfanylacetohydrazide |
| SMILES | COc1ccc(Cl)c2sc(NNC(=O)CSc3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C16H13Cl2N3O2S2/c1-23-12-7-6-11(18)15-14(12)19-16(25-15)21-20-13(22)8-24-10-4-2-9(17)3-5-10/h2-7H,8H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | ZUWLKOPYBDNBDB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|