C22H18ClN3O2S — CID 121082762
1-benzhydryl-3-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)urea (PubChem CID 121082762) has the molecular formula C22H18ClN3O2S and a molecular weight of 423.93 g/mol. Its IUPAC name is 1-benzhydryl-3-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-benzhydryl-3-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 121082762 |
| Molecular Formula | C22H18ClN3O2S |
| Molecular Weight | 423.93 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 1-benzhydryl-3-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)urea |
| SMILES | COc1ccc(Cl)c2sc(NC(=O)NC(c3ccccc3)c3ccccc3)nc12 |
| InChI | InChI=1S/C22H18ClN3O2S/c1-28-17-13-12-16(23)20-19(17)25-22(29-20)26-21(27)24-18(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-13,18H,1H3,(H2,24,25,26,27) |
| InChIKey | PHFSRSVSGZSPCN-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.93 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |