C16H14ClN3O2S — CID 121081229
1-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-3-(3-methylphenyl)urea (PubChem CID 121081229) has the molecular formula C16H14ClN3O2S and a molecular weight of 347.83 g/mol. Its IUPAC name is 1-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-3-(3-methylphenyl)urea.
| Compound Name | 1-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 121081229 |
| Molecular Formula | C16H14ClN3O2S |
| Molecular Weight | 347.83 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 1-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-3-(3-methylphenyl)urea |
| SMILES | COc1ccc(Cl)c2sc(NC(=O)Nc3cccc(C)c3)nc12 |
| InChI | InChI=1S/C16H14ClN3O2S/c1-9-4-3-5-10(8-9)18-15(21)20-16-19-13-12(22-2)7-6-11(17)14(13)23-16/h3-8H,1-2H3,(H2,18,19,20,21) |
| InChIKey | ICOVSDAWRJTGAE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.83 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |