C11H12ClN3O2S — CID 121082763
1-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-3-ethylurea (PubChem CID 121082763) has the molecular formula C11H12ClN3O2S and a molecular weight of 285.76 g/mol. Its IUPAC name is 1-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-3-ethylurea.
| Compound Name | 1-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-3-ethylurea |
|---|---|
| PubChem CID | 121082763 |
| Molecular Formula | C11H12ClN3O2S |
| Molecular Weight | 285.76 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 1-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-3-ethylurea |
| SMILES | CCNC(=O)Nc1nc2c(OC)ccc(Cl)c2s1 |
| InChI | InChI=1S/C11H12ClN3O2S/c1-3-13-10(16)15-11-14-8-7(17-2)5-4-6(12)9(8)18-11/h4-5H,3H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | ITAGAFPJTRLGML-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.76 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |