C17H16ClN3O4S2 — CID 41074302
N'-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-3-ethylsulfonylbenzohydrazide (PubChem CID 41074302) has the molecular formula C17H16ClN3O4S2 and a molecular weight of 425.92 g/mol. Its IUPAC name is N'-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-3-ethylsulfonylbenzohydrazide.
| Compound Name | N'-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-3-ethylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 41074302 |
| Molecular Formula | C17H16ClN3O4S2 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | N'-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-3-ethylsulfonylbenzohydrazide |
| SMILES | CCS(=O)(=O)c1cccc(C(=O)NNc2nc3c(OC)ccc(Cl)c3s2)c1 |
| InChI | InChI=1S/C17H16ClN3O4S2/c1-3-27(23,24)11-6-4-5-10(9-11)16(22)20-21-17-19-14-13(25-2)8-7-12(18)15(14)26-17/h4-9H,3H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | RNDQKPCYGFQLAW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|