C16H14ClN3O2S2 — CID 7600488
2-(4-chlorophenyl)sulfanyl-N'-(6-methoxy-1,3-benzothiazol-2-yl)acetohydrazide (PubChem CID 7600488) has the molecular formula C16H14ClN3O2S2 and a molecular weight of 379.89 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N'-(6-methoxy-1,3-benzothiazol-2-yl)acetohydrazide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N'-(6-methoxy-1,3-benzothiazol-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 7600488 |
| Molecular Formula | C16H14ClN3O2S2 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N'-(6-methoxy-1,3-benzothiazol-2-yl)acetohydrazide |
| SMILES | COc1ccc2nc(NNC(=O)CSc3ccc(Cl)cc3)sc2c1 |
| InChI | InChI=1S/C16H14ClN3O2S2/c1-22-11-4-7-13-14(8-11)24-16(18-13)20-19-15(21)9-23-12-5-2-10(17)3-6-12/h2-8H,9H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | WKFHKFCRRYWNBL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|