C22H18ClN3O4S — CID 41074352
3-[4-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)piperazine-1-carbonyl]chromen-2-one (PubChem CID 41074352) has the molecular formula C22H18ClN3O4S and a molecular weight of 455.92 g/mol. Its IUPAC name is 3-[4-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)piperazine-1-carbonyl]chromen-2-one.
| Compound Name | 3-[4-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)piperazine-1-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 41074352 |
| Molecular Formula | C22H18ClN3O4S |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | 3-[4-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)piperazine-1-carbonyl]chromen-2-one |
| SMILES | COc1ccc(Cl)c2sc(N3CCN(C(=O)c4cc5ccccc5oc4=O)CC3)nc12 |
| InChI | InChI=1S/C22H18ClN3O4S/c1-29-17-7-6-15(23)19-18(17)24-22(31-19)26-10-8-25(9-11-26)20(27)14-12-13-4-2-3-5-16(13)30-21(14)28/h2-7,12H,8-11H2,1H3 |
| InChIKey | RWOCYOGHDQDYTM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|