C19H16ClN5O6S — CID 41074414
[4-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-(3,5-dinitrophenyl)methanone (PubChem CID 41074414) has the molecular formula C19H16ClN5O6S and a molecular weight of 477.89 g/mol. Its IUPAC name is [4-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-(3,5-dinitrophenyl)methanone.
| Compound Name | [4-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-(3,5-dinitrophenyl)methanone |
|---|---|
| PubChem CID | 41074414 |
| Molecular Formula | C19H16ClN5O6S |
| Molecular Weight | 477.89 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | [4-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-(3,5-dinitrophenyl)methanone |
| SMILES | COc1ccc(Cl)c2sc(N3CCN(C(=O)c4cc([N+](=O)[O-])cc([N+](=O)[O-])c4)CC3)nc12 |
| InChI | InChI=1S/C19H16ClN5O6S/c1-31-15-3-2-14(20)17-16(15)21-19(32-17)23-6-4-22(5-7-23)18(26)11-8-12(24(27)28)10-13(9-11)25(29)30/h2-3,8-10H,4-7H2,1H3 |
| InChIKey | LTLRAHMRJUSPGJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 131.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.89 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|