C20H19N5O5S — CID 41116025
(3,5-dinitrophenyl)-[4-(4-ethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]methanone (PubChem CID 41116025) has the molecular formula C20H19N5O5S and a molecular weight of 441.47 g/mol. Its IUPAC name is (3,5-dinitrophenyl)-[4-(4-ethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]methanone.
| Compound Name | (3,5-dinitrophenyl)-[4-(4-ethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 41116025 |
| Molecular Formula | C20H19N5O5S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | (3,5-dinitrophenyl)-[4-(4-ethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]methanone |
| SMILES | CCc1cccc2sc(N3CCN(C(=O)c4cc([N+](=O)[O-])cc([N+](=O)[O-])c4)CC3)nc12 |
| InChI | InChI=1S/C20H19N5O5S/c1-2-13-4-3-5-17-18(13)21-20(31-17)23-8-6-22(7-9-23)19(26)14-10-15(24(27)28)12-16(11-14)25(29)30/h3-5,10-12H,2,6-9H2,1H3 |
| InChIKey | MJONFJUQOCWUGO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 122.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|