C18H11ClN2O4S — CID 7590071
N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide (PubChem CID 7590071) has the molecular formula C18H11ClN2O4S and a molecular weight of 386.82 g/mol. Its IUPAC name is N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide.
| Compound Name | N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 7590071 |
| Molecular Formula | C18H11ClN2O4S |
| Molecular Weight | 386.82 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide |
| SMILES | COc1ccc(Cl)c2sc(NC(=O)c3cc4ccccc4oc3=O)nc12 |
| InChI | InChI=1S/C18H11ClN2O4S/c1-24-13-7-6-11(19)15-14(13)20-18(26-15)21-16(22)10-8-9-4-2-3-5-12(9)25-17(10)23/h2-8H,1H3,(H,20,21,22) |
| InChIKey | WIIIUELVMGFDHP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.82 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|