C22H23N5O5 — CID 91948131
N-[3-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)propyl]-4-prop-2-enoxy-1-benzofuran-6-carboxamide (PubChem CID 91948131) has the molecular formula C22H23N5O5 and a molecular weight of 437.46 g/mol. Its IUPAC name is N-[3-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)propyl]-4-prop-2-enoxy-1-benzofuran-6-carboxamide.
| Compound Name | N-[3-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)propyl]-4-prop-2-enoxy-1-benzofuran-6-carboxamide |
|---|---|
| PubChem CID | 91948131 |
| Molecular Formula | C22H23N5O5 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N-[3-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)propyl]-4-prop-2-enoxy-1-benzofuran-6-carboxamide |
| SMILES | C=CCOc1cc(C(=O)NCCCc2nc3c([nH]2)c(=O)n(C)c(=O)n3C)cc2occc12 |
| InChI | InChI=1S/C22H23N5O5/c1-4-9-31-15-11-13(12-16-14(15)7-10-32-16)20(28)23-8-5-6-17-24-18-19(25-17)26(2)22(30)27(3)21(18)29/h4,7,10-12H,1,5-6,8-9H2,2-3H3,(H,23,28)(H,24,25) |
| InChIKey | URLNLUDDIPWUJO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|