C18H21NO4 — CID 95739221
[(2S,6S)-2,6-dimethylmorpholin-4-yl]-(4-prop-2-enoxy-1-benzofuran-6-yl)methanone (PubChem CID 95739221) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is [(2S,6S)-2,6-dimethylmorpholin-4-yl]-(4-prop-2-enoxy-1-benzofuran-6-yl)methanone.
| Compound Name | [(2S,6S)-2,6-dimethylmorpholin-4-yl]-(4-prop-2-enoxy-1-benzofuran-6-yl)methanone |
|---|---|
| PubChem CID | 95739221 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | [(2S,6S)-2,6-dimethylmorpholin-4-yl]-(4-prop-2-enoxy-1-benzofuran-6-yl)methanone |
| SMILES | C=CCOc1cc(C(=O)N2C[C@H](C)O[C@@H](C)C2)cc2occc12 |
| InChI | InChI=1S/C18H21NO4/c1-4-6-21-16-8-14(9-17-15(16)5-7-22-17)18(20)19-10-12(2)23-13(3)11-19/h4-5,7-9,12-13H,1,6,10-11H2,2-3H3/t12-,13-/m0/s1 |
| InChIKey | GHHHKLGGRHCWKL-STQMWFEESA-N |
| XLogP | 3.25 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|