C18H25NO3 — CID 82052122
2-(2,6-dimethylmorpholin-4-yl)-1-(5-methyl-2-prop-2-enoxyphenyl)ethanone (PubChem CID 82052122) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is 2-(2,6-dimethylmorpholin-4-yl)-1-(5-methyl-2-prop-2-enoxyphenyl)ethanone.
| Compound Name | 2-(2,6-dimethylmorpholin-4-yl)-1-(5-methyl-2-prop-2-enoxyphenyl)ethanone |
|---|---|
| PubChem CID | 82052122 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 2-(2,6-dimethylmorpholin-4-yl)-1-(5-methyl-2-prop-2-enoxyphenyl)ethanone |
| SMILES | C=CCOc1ccc(C)cc1C(=O)CN1CC(C)OC(C)C1 |
| InChI | InChI=1S/C18H25NO3/c1-5-8-21-18-7-6-13(2)9-16(18)17(20)12-19-10-14(3)22-15(4)11-19/h5-7,9,14-15H,1,8,10-12H2,2-4H3 |
| InChIKey | ABOMWSUCQWDUQA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|