C15H20O2S — CID 82052126
1-(5-methyl-2-prop-2-enoxyphenyl)-2-propylsulfanylethanone (PubChem CID 82052126) has the molecular formula C15H20O2S and a molecular weight of 264.39 g/mol. Its IUPAC name is 1-(5-methyl-2-prop-2-enoxyphenyl)-2-propylsulfanylethanone.
| Compound Name | 1-(5-methyl-2-prop-2-enoxyphenyl)-2-propylsulfanylethanone |
|---|---|
| PubChem CID | 82052126 |
| Molecular Formula | C15H20O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-(5-methyl-2-prop-2-enoxyphenyl)-2-propylsulfanylethanone |
| SMILES | C=CCOc1ccc(C)cc1C(=O)CSCCC |
| InChI | InChI=1S/C15H20O2S/c1-4-8-17-15-7-6-12(3)10-13(15)14(16)11-18-9-5-2/h4,6-7,10H,1,5,8-9,11H2,2-3H3 |
| InChIKey | NKMRUZPRMLCGCG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|