C14H18O4S — CID 82052395
2-ethoxy-5-(2-propylsulfanylacetyl)benzoic acid (PubChem CID 82052395) has the molecular formula C14H18O4S and a molecular weight of 282.36 g/mol. Its IUPAC name is 2-ethoxy-5-(2-propylsulfanylacetyl)benzoic acid.
| Compound Name | 2-ethoxy-5-(2-propylsulfanylacetyl)benzoic acid |
|---|---|
| PubChem CID | 82052395 |
| Molecular Formula | C14H18O4S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2-ethoxy-5-(2-propylsulfanylacetyl)benzoic acid |
| SMILES | CCCSCC(=O)c1ccc(OCC)c(C(=O)O)c1 |
| InChI | InChI=1S/C14H18O4S/c1-3-7-19-9-12(15)10-5-6-13(18-4-2)11(8-10)14(16)17/h5-6,8H,3-4,7,9H2,1-2H3,(H,16,17) |
| InChIKey | FPSJHCJXPGEABW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|