C16H21ClN2O3 — CID 97151706
(2R,6R)-4-[(3-chloro-4-prop-2-enoxyphenyl)methyl]-6-methylmorpholine-2-carboxamide (PubChem CID 97151706) has the molecular formula C16H21ClN2O3 and a molecular weight of 324.81 g/mol. Its IUPAC name is (2R,6R)-4-[(3-chloro-4-prop-2-enoxyphenyl)methyl]-6-methylmorpholine-2-carboxamide.
| Compound Name | (2R,6R)-4-[(3-chloro-4-prop-2-enoxyphenyl)methyl]-6-methylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 97151706 |
| Molecular Formula | C16H21ClN2O3 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | (2R,6R)-4-[(3-chloro-4-prop-2-enoxyphenyl)methyl]-6-methylmorpholine-2-carboxamide |
| SMILES | C=CCOc1ccc(CN2C[C@@H](C)O[C@@H](C(N)=O)C2)cc1Cl |
| InChI | InChI=1S/C16H21ClN2O3/c1-3-6-21-14-5-4-12(7-13(14)17)9-19-8-11(2)22-15(10-19)16(18)20/h3-5,7,11,15H,1,6,8-10H2,2H3,(H2,18,20)/t11-,15-/m1/s1 |
| InChIKey | VEPUVPFLEZLZPP-IAQYHMDHSA-N |
| XLogP | 1.98 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|